C17H24FN3O2S — CID 8767842
1-[[(2R)-2-(2-fluorophenoxy)propanoyl]amino]-3-[(1S,2R)-2-methylcyclohexyl]thiourea (PubChem CID 8767842) has the molecular formula C17H24FN3O2S and a molecular weight of 353.46 g/mol. Its IUPAC name is 1-[[(2R)-2-(2-fluorophenoxy)propanoyl]amino]-3-[(1S,2R)-2-methylcyclohexyl]thiourea.
| Compound Name | 1-[[(2R)-2-(2-fluorophenoxy)propanoyl]amino]-3-[(1S,2R)-2-methylcyclohexyl]thiourea |
|---|---|
| PubChem CID | 8767842 |
| Molecular Formula | C17H24FN3O2S |
| Molecular Weight | 353.46 g/mol |
| Exact Mass | 353.16 |
| IUPAC Name | 1-[[(2R)-2-(2-fluorophenoxy)propanoyl]amino]-3-[(1S,2R)-2-methylcyclohexyl]thiourea |
| SMILES | C[C@@H]1CCCC[C@@H]1NC(=S)NNC(=O)[C@@H](C)Oc1ccccc1F |
| InChI | InChI=1S/C17H24FN3O2S/c1-11-7-3-5-9-14(11)19-17(24)21-20-16(22)12(2)23-15-10-6-4-8-13(15)18/h4,6,8,10-12,14H,3,5,7,9H2,1-2H3,(H,20,22)(H2,19,21,24)/t11-,12-,14+/m1/s1 |
| InChIKey | BSNDYWGCEHHWCR-BZPMIXESSA-N |
| XLogP | 2.67 |
| TPSA | 62.39 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.46 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|