C14H17BrN2O5S — CID 9090884
(3S)-N'-[(2R)-2-(3-bromophenoxy)propanoyl]-1,1-dioxothiolane-3-carbohydrazide (PubChem CID 9090884) has the molecular formula C14H17BrN2O5S and a molecular weight of 405.27 g/mol. Its IUPAC name is (3S)-N'-[(2R)-2-(3-bromophenoxy)propanoyl]-1,1-dioxothiolane-3-carbohydrazide.
| Compound Name | (3S)-N'-[(2R)-2-(3-bromophenoxy)propanoyl]-1,1-dioxothiolane-3-carbohydrazide |
|---|---|
| PubChem CID | 9090884 |
| Molecular Formula | C14H17BrN2O5S |
| Molecular Weight | 405.27 g/mol |
| Exact Mass | 404.00 |
| IUPAC Name | (3S)-N'-[(2R)-2-(3-bromophenoxy)propanoyl]-1,1-dioxothiolane-3-carbohydrazide |
| SMILES | C[C@@H](Oc1cccc(Br)c1)C(=O)NNC(=O)[C@@H]1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C14H17BrN2O5S/c1-9(22-12-4-2-3-11(15)7-12)13(18)16-17-14(19)10-5-6-23(20,21)8-10/h2-4,7,9-10H,5-6,8H2,1H3,(H,16,18)(H,17,19)/t9-,10-/m1/s1 |
| InChIKey | KWCVBEMQHCHURF-NXEZZACHSA-N |
| XLogP | 0.80 |
| TPSA | 101.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.27 |
| LogP ≤ 5 | 0.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|