C16H13NO5 — CID 87764780
8,9-dimethoxy-3-oxo-2H-benzo[h]isoquinoline-6-carboxylic acid (PubChem CID 87764780) has the molecular formula C16H13NO5 and a molecular weight of 299.28 g/mol. Its IUPAC name is 8,9-dimethoxy-3-oxo-2H-benzo[h]isoquinoline-6-carboxylic acid.
| Compound Name | 8,9-dimethoxy-3-oxo-2H-benzo[h]isoquinoline-6-carboxylic acid |
|---|---|
| PubChem CID | 87764780 |
| Molecular Formula | C16H13NO5 |
| Molecular Weight | 299.28 g/mol |
| Exact Mass | 299.08 |
| IUPAC Name | 8,9-dimethoxy-3-oxo-2H-benzo[h]isoquinoline-6-carboxylic acid |
| SMILES | COc1cc2c(C(=O)O)cc3cc(=O)[nH]cc3c2cc1OC |
| InChI | InChI=1S/C16H13NO5/c1-21-13-5-9-10(6-14(13)22-2)12-7-17-15(18)4-8(12)3-11(9)16(19)20/h3-7H,1-2H3,(H,17,18)(H,19,20) |
| InChIKey | GFXPPWLBIMFDDO-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 88.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.28 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|