C24H27NO5 — CID 66561042
piperidin-1-yl-(2,3,6,7-tetramethoxyphenanthren-9-yl)methanone (PubChem CID 66561042) has the molecular formula C24H27NO5 and a molecular weight of 409.48 g/mol. Its IUPAC name is piperidin-1-yl-(2,3,6,7-tetramethoxyphenanthren-9-yl)methanone.
| Compound Name | piperidin-1-yl-(2,3,6,7-tetramethoxyphenanthren-9-yl)methanone |
|---|---|
| PubChem CID | 66561042 |
| Molecular Formula | C24H27NO5 |
| Molecular Weight | 409.48 g/mol |
| Exact Mass | 409.19 |
| IUPAC Name | piperidin-1-yl-(2,3,6,7-tetramethoxyphenanthren-9-yl)methanone |
| SMILES | COc1cc2cc(C(=O)N3CCCCC3)c3cc(OC)c(OC)cc3c2cc1OC |
| InChI | InChI=1S/C24H27NO5/c1-27-20-11-15-10-19(24(26)25-8-6-5-7-9-25)18-14-23(30-4)22(29-3)13-17(18)16(15)12-21(20)28-2/h10-14H,5-9H2,1-4H3 |
| InChIKey | XIGKBANGUJEUJS-UHFFFAOYSA-N |
| XLogP | 4.65 |
| TPSA | 57.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.48 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|