C22H20O8 — CID 163087748
(3,5-diacetyloxy-6,7-dimethoxyphenanthren-2-yl) acetate (PubChem CID 163087748) has the molecular formula C22H20O8 and a molecular weight of 412.39 g/mol. Its IUPAC name is (3,5-diacetyloxy-6,7-dimethoxyphenanthren-2-yl) acetate.
| Compound Name | (3,5-diacetyloxy-6,7-dimethoxyphenanthren-2-yl) acetate |
|---|---|
| PubChem CID | 163087748 |
| Molecular Formula | C22H20O8 |
| Molecular Weight | 412.39 g/mol |
| Exact Mass | 412.12 |
| IUPAC Name | (3,5-diacetyloxy-6,7-dimethoxyphenanthren-2-yl) acetate |
| SMILES | COc1cc2ccc3cc(OC(C)=O)c(OC(C)=O)cc3c2c(OC(C)=O)c1OC |
| InChI | InChI=1S/C22H20O8/c1-11(23)28-17-8-14-6-7-15-9-19(26-4)21(27-5)22(30-13(3)25)20(15)16(14)10-18(17)29-12(2)24/h6-10H,1-5H3 |
| InChIKey | SANJTRZBUXXKLH-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 97.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.39 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|