C17H18O7 — CID 73013836
methyl 5-acetyloxy-4,6,7-trimethoxynaphthalene-2-carboxylate (PubChem CID 73013836) has the molecular formula C17H18O7 and a molecular weight of 334.32 g/mol. Its IUPAC name is methyl 5-acetyloxy-4,6,7-trimethoxynaphthalene-2-carboxylate.
| Compound Name | methyl 5-acetyloxy-4,6,7-trimethoxynaphthalene-2-carboxylate |
|---|---|
| PubChem CID | 73013836 |
| Molecular Formula | C17H18O7 |
| Molecular Weight | 334.32 g/mol |
| Exact Mass | 334.11 |
| IUPAC Name | methyl 5-acetyloxy-4,6,7-trimethoxynaphthalene-2-carboxylate |
| SMILES | COC(=O)c1cc(OC)c2c(OC(C)=O)c(OC)c(OC)cc2c1 |
| InChI | InChI=1S/C17H18O7/c1-9(18)24-16-14-10(7-13(21-3)15(16)22-4)6-11(17(19)23-5)8-12(14)20-2/h6-8H,1-5H3 |
| InChIKey | QDJQUEVFTUMTHY-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 80.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.32 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|