C20H17NO4 — CID 19906374
4-[(7-carbamoylnaphthalen-1-yl)methyl]-3-methoxybenzoic acid (PubChem CID 19906374) has the molecular formula C20H17NO4 and a molecular weight of 335.36 g/mol. Its IUPAC name is 4-[(7-carbamoylnaphthalen-1-yl)methyl]-3-methoxybenzoic acid.
| Compound Name | 4-[(7-carbamoylnaphthalen-1-yl)methyl]-3-methoxybenzoic acid |
|---|---|
| PubChem CID | 19906374 |
| Molecular Formula | C20H17NO4 |
| Molecular Weight | 335.36 g/mol |
| Exact Mass | 335.12 |
| IUPAC Name | 4-[(7-carbamoylnaphthalen-1-yl)methyl]-3-methoxybenzoic acid |
| SMILES | COc1cc(C(=O)O)ccc1Cc1cccc2ccc(C(N)=O)cc12 |
| InChI | InChI=1S/C20H17NO4/c1-25-18-11-16(20(23)24)8-6-14(18)9-13-4-2-3-12-5-7-15(19(21)22)10-17(12)13/h2-8,10-11H,9H2,1H3,(H2,21,22)(H,23,24) |
| InChIKey | JPUCMGQYDIMRMR-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 89.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.36 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |