C42H38NS2Si- — CID 132991223
N-[4-[2-[13-[2-tri(propan-2-yl)silylethynyl]pentacen-6-yl]ethynyl]phenyl]carbamodithioate (PubChem CID 132991223) has the molecular formula C42H38NS2Si- and a molecular weight of 648.99 g/mol. Its IUPAC name is N-[4-[2-[13-[2-tri(propan-2-yl)silylethynyl]pentacen-6-yl]ethynyl]phenyl]carbamodithioate.
| Compound Name | N-[4-[2-[13-[2-tri(propan-2-yl)silylethynyl]pentacen-6-yl]ethynyl]phenyl]carbamodithioate |
|---|---|
| PubChem CID | 132991223 |
| Molecular Formula | C42H38NS2Si- |
| Molecular Weight | 648.99 g/mol |
| Exact Mass | 648.22 |
| IUPAC Name | N-[4-[2-[13-[2-tri(propan-2-yl)silylethynyl]pentacen-6-yl]ethynyl]phenyl]carbamodithioate |
| SMILES | CC(C)[Si](C#Cc1c2cc3ccccc3cc2c(C#Cc2ccc(NC(=S)[S-])cc2)c2cc3ccccc3cc12)(C(C)C)C(C)C |
| InChI | InChI=1S/C42H39NS2Si/c1-27(2)46(28(3)4,29(5)6)22-21-37-40-25-33-13-9-7-11-31(33)23-38(40)36(20-17-30-15-18-35(19-16-30)43-42(44)45)39-24-32-12-8-10-14-34(32)26-41(37)39/h7-16,18-19,23-29H,1-6H3,(H2,43,44,45)/p-1 |
| InChIKey | NXLPRFPRZXCSNK-UHFFFAOYSA-M |
| XLogP | 11.51 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 648.99 |
| LogP ≤ 5 | 11.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'}, {'alert_name': 'thiol_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|