C38H56N8Si2 — CID 139186519
2-ethynyl-3,6-diimino-5-[2-tri(propan-2-yl)silylethynyl]cyclohexa-1,4-diene-1,4-diamine (PubChem CID 139186519) has the molecular formula C38H56N8Si2 and a molecular weight of 681.09 g/mol. Its IUPAC name is 2-ethynyl-3,6-diimino-5-[2-tri(propan-2-yl)silylethynyl]cyclohexa-1,4-diene-1,4-diamine.
| Compound Name | 2-ethynyl-3,6-diimino-5-[2-tri(propan-2-yl)silylethynyl]cyclohexa-1,4-diene-1,4-diamine |
|---|---|
| PubChem CID | 139186519 |
| Molecular Formula | C38H56N8Si2 |
| Molecular Weight | 681.09 g/mol |
| Exact Mass | 680.42 |
| IUPAC Name | 2-ethynyl-3,6-diimino-5-[2-tri(propan-2-yl)silylethynyl]cyclohexa-1,4-diene-1,4-diamine |
| SMILES | [H]/N=C1/C(N)=C(C#C[Si](C(C)C)(C(C)C)C(C)C)/C(=N\[H])C(N)=C1C#C.[H]/N=C1/C(N)=C(C#C[Si](C(C)C)(C(C)C)C(C)C)/C(=N\[H])C(N)=C1C#C |
| InChI | InChI=1S/2C19H28N4Si/c2*1-8-14-16(20)18(22)15(19(23)17(14)21)9-10-24(11(2)3,12(4)5)13(6)7/h2*1,11-13,20,23H,21-22H2,2-7H3/b2*20-16+,23-19+ |
| InChIKey | BXGXILRDOOXEQW-PIMOFJKWSA-N |
| XLogP | 6.64 |
| TPSA | 199.48 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 48 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 681.09 |
| LogP ≤ 5 | 6.64 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|