C33H34Si — CID 102419501
2-(6-ethynyl-3-pentacyclo[6.6.6.02,7.09,14.015,20]icosa-2,4,6,9,11,13,15,17,19-nonaenyl)ethynyl-tri(propan-2-yl)silane (PubChem CID 102419501) has the molecular formula C33H34Si and a molecular weight of 458.72 g/mol. Its IUPAC name is 2-(6-ethynyl-3-pentacyclo[6.6.6.02,7.09,14.015,20]icosa-2,4,6,9,11,13,15,17,19-nonaenyl)ethynyl-tri(propan-2-yl)silane.
| Compound Name | 2-(6-ethynyl-3-pentacyclo[6.6.6.02,7.09,14.015,20]icosa-2,4,6,9,11,13,15,17,19-nonaenyl)ethynyl-tri(propan-2-yl)silane |
|---|---|
| PubChem CID | 102419501 |
| Molecular Formula | C33H34Si |
| Molecular Weight | 458.72 g/mol |
| Exact Mass | 458.24 |
| IUPAC Name | 2-(6-ethynyl-3-pentacyclo[6.6.6.02,7.09,14.015,20]icosa-2,4,6,9,11,13,15,17,19-nonaenyl)ethynyl-tri(propan-2-yl)silane |
| SMILES | C#Cc1ccc(C#C[Si](C(C)C)(C(C)C)C(C)C)c2c1C1c3ccccc3C2c2ccccc21 |
| InChI | InChI=1S/C33H34Si/c1-8-24-17-18-25(19-20-34(21(2)3,22(4)5)23(6)7)31-30(24)32-26-13-9-11-15-28(26)33(31)29-16-12-10-14-27(29)32/h1,9-18,21-23,32-33H,2-7H3 |
| InChIKey | QXZBUZJBKWBCGU-UHFFFAOYSA-N |
| XLogP | 8.22 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.72 |
| LogP ≤ 5 | 8.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|