C28H44N2SSi2 — CID 102165434
tri(propan-2-yl)-[2-[4-[2-tri(propan-2-yl)silylethynyl]-2,1,3-benzothiadiazol-7-yl]ethynyl]silane (PubChem CID 102165434) has the molecular formula C28H44N2SSi2 and a molecular weight of 496.91 g/mol. Its IUPAC name is tri(propan-2-yl)-[2-[4-[2-tri(propan-2-yl)silylethynyl]-2,1,3-benzothiadiazol-7-yl]ethynyl]silane.
| Compound Name | tri(propan-2-yl)-[2-[4-[2-tri(propan-2-yl)silylethynyl]-2,1,3-benzothiadiazol-7-yl]ethynyl]silane |
|---|---|
| PubChem CID | 102165434 |
| Molecular Formula | C28H44N2SSi2 |
| Molecular Weight | 496.91 g/mol |
| Exact Mass | 496.28 |
| IUPAC Name | tri(propan-2-yl)-[2-[4-[2-tri(propan-2-yl)silylethynyl]-2,1,3-benzothiadiazol-7-yl]ethynyl]silane |
| SMILES | CC(C)[Si](C#Cc1ccc(C#C[Si](C(C)C)(C(C)C)C(C)C)c2nsnc12)(C(C)C)C(C)C |
| InChI | InChI=1S/C28H44N2SSi2/c1-19(2)32(20(3)4,21(5)6)17-15-25-13-14-26(28-27(25)29-31-30-28)16-18-33(22(7)8,23(9)10)24(11)12/h13-14,19-24H,1-12H3 |
| InChIKey | RGWGLTZCRFXIDW-UHFFFAOYSA-N |
| XLogP | 8.83 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.91 |
| LogP ≤ 5 | 8.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|