C17H24BrFSi — CID 176789274
2-(5-bromo-2-fluorophenyl)ethynyl-tri(propan-2-yl)silane (PubChem CID 176789274) has the molecular formula C17H24BrFSi and a molecular weight of 355.37 g/mol. Its IUPAC name is 2-(5-bromo-2-fluorophenyl)ethynyl-tri(propan-2-yl)silane.
| Compound Name | 2-(5-bromo-2-fluorophenyl)ethynyl-tri(propan-2-yl)silane |
|---|---|
| PubChem CID | 176789274 |
| Molecular Formula | C17H24BrFSi |
| Molecular Weight | 355.37 g/mol |
| Exact Mass | 354.08 |
| IUPAC Name | 2-(5-bromo-2-fluorophenyl)ethynyl-tri(propan-2-yl)silane |
| SMILES | CC(C)[Si](C#Cc1cc(Br)ccc1F)(C(C)C)C(C)C |
| InChI | InChI=1S/C17H24BrFSi/c1-12(2)20(13(3)4,14(5)6)10-9-15-11-16(18)7-8-17(15)19/h7-8,11-14H,1-6H3 |
| InChIKey | UPLTVPRTKUHHIX-UHFFFAOYSA-N |
| XLogP | 6.16 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.37 |
| LogP ≤ 5 | 6.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|