C80H102O2Si4 — CID 138984209
2,5-bis[9,10-bis[2-tri(propan-2-yl)silylethynyl]anthracen-2-yl]terephthalaldehyde (PubChem CID 138984209) has the molecular formula C80H102O2Si4 and a molecular weight of 1208.04 g/mol. Its IUPAC name is 2,5-bis[9,10-bis[2-tri(propan-2-yl)silylethynyl]anthracen-2-yl]terephthalaldehyde.
| Compound Name | 2,5-bis[9,10-bis[2-tri(propan-2-yl)silylethynyl]anthracen-2-yl]terephthalaldehyde |
|---|---|
| PubChem CID | 138984209 |
| Molecular Formula | C80H102O2Si4 |
| Molecular Weight | 1208.04 g/mol |
| Exact Mass | 1206.70 |
| IUPAC Name | 2,5-bis[9,10-bis[2-tri(propan-2-yl)silylethynyl]anthracen-2-yl]terephthalaldehyde |
| SMILES | CC(C)[Si](C#Cc1c2ccccc2c(C#C[Si](C(C)C)(C(C)C)C(C)C)c2cc(-c3cc(C=O)c(-c4ccc5c(C#C[Si](C(C)C)(C(C)C)C(C)C)c6ccccc6c(C#C[Si](C(C)C)(C(C)C)C(C)C)c5c4)cc3C=O)ccc12)(C(C)C)C(C)C |
| InChI | InChI=1S/C80H102O2Si4/c1-51(2)83(52(3)4,53(5)6)41-37-73-67-29-25-27-31-69(67)75(39-43-85(57(13)14,58(15)16)59(17)18)79-45-63(33-35-71(73)79)77-47-66(50-82)78(48-65(77)49-81)64-34-36-72-74(38-42-84(54(7)8,55(9)10)56(11)12)68-30-26-28-32-70(68)76(80(72)46-64)40-44-86(60(19)20,61(21)22)62(23)24/h25-36,45-62H,1-24H3 |
| InChIKey | YPXPMKGCFBVAPN-UHFFFAOYSA-N |
| XLogP | 23.54 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 86 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1208.04 |
| LogP ≤ 5 | 23.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|