C46H54Br2O2Si2 — CID 140746088
3,10-dibromo-9-methoxy-6,13-bis[2-tri(propan-2-yl)silylethynyl]pentacene-2-carbaldehyde (PubChem CID 140746088) has the molecular formula C46H54Br2O2Si2 and a molecular weight of 854.92 g/mol. Its IUPAC name is 3,10-dibromo-9-methoxy-6,13-bis[2-tri(propan-2-yl)silylethynyl]pentacene-2-carbaldehyde.
| Compound Name | 3,10-dibromo-9-methoxy-6,13-bis[2-tri(propan-2-yl)silylethynyl]pentacene-2-carbaldehyde |
|---|---|
| PubChem CID | 140746088 |
| Molecular Formula | C46H54Br2O2Si2 |
| Molecular Weight | 854.92 g/mol |
| Exact Mass | 852.20 |
| IUPAC Name | 3,10-dibromo-9-methoxy-6,13-bis[2-tri(propan-2-yl)silylethynyl]pentacene-2-carbaldehyde |
| SMILES | COc1cc2cc3c(C#C[Si](C(C)C)(C(C)C)C(C)C)c4cc5cc(Br)c(C=O)cc5cc4c(C#C[Si](C(C)C)(C(C)C)C(C)C)c3cc2cc1Br |
| InChI | InChI=1S/C46H54Br2O2Si2/c1-27(2)51(28(3)4,29(5)6)16-14-38-40-19-33-18-37(26-49)44(47)23-34(33)20-41(40)39(15-17-52(30(7)8,31(9)10)32(11)12)43-22-36-25-46(50-13)45(48)24-35(36)21-42(38)43/h18-32H,1-13H3 |
| InChIKey | SGTWJVPLIPFZDB-UHFFFAOYSA-N |
| XLogP | 14.78 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 854.92 |
| LogP ≤ 5 | 14.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|