C28H36O6Si — CID 162404063
3,4,5-trimethoxy-2-[6-[2-tri(propan-2-yl)silylethynyl]-1,3-benzodioxol-5-yl]benzaldehyde (PubChem CID 162404063) has the molecular formula C28H36O6Si and a molecular weight of 496.68 g/mol. Its IUPAC name is 3,4,5-trimethoxy-2-[6-[2-tri(propan-2-yl)silylethynyl]-1,3-benzodioxol-5-yl]benzaldehyde.
| Compound Name | 3,4,5-trimethoxy-2-[6-[2-tri(propan-2-yl)silylethynyl]-1,3-benzodioxol-5-yl]benzaldehyde |
|---|---|
| PubChem CID | 162404063 |
| Molecular Formula | C28H36O6Si |
| Molecular Weight | 496.68 g/mol |
| Exact Mass | 496.23 |
| IUPAC Name | 3,4,5-trimethoxy-2-[6-[2-tri(propan-2-yl)silylethynyl]-1,3-benzodioxol-5-yl]benzaldehyde |
| SMILES | COc1cc(C=O)c(-c2cc3c(cc2C#C[Si](C(C)C)(C(C)C)C(C)C)OCO3)c(OC)c1OC |
| InChI | InChI=1S/C28H36O6Si/c1-17(2)35(18(3)4,19(5)6)11-10-20-12-23-24(34-16-33-23)14-22(20)26-21(15-29)13-25(30-7)27(31-8)28(26)32-9/h12-15,17-19H,16H2,1-9H3 |
| InChIKey | QQQPSQUTFCYUOM-UHFFFAOYSA-N |
| XLogP | 6.49 |
| TPSA | 63.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.68 |
| LogP ≤ 5 | 6.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|