C18H28O5Si — CID 25156881
7-methoxy-4-tri(propan-2-yl)silyloxy-1,3-benzodioxole-5-carbaldehyde (PubChem CID 25156881) has the molecular formula C18H28O5Si and a molecular weight of 352.50 g/mol. Its IUPAC name is 7-methoxy-4-tri(propan-2-yl)silyloxy-1,3-benzodioxole-5-carbaldehyde.
| Compound Name | 7-methoxy-4-tri(propan-2-yl)silyloxy-1,3-benzodioxole-5-carbaldehyde |
|---|---|
| PubChem CID | 25156881 |
| Molecular Formula | C18H28O5Si |
| Molecular Weight | 352.50 g/mol |
| Exact Mass | 352.17 |
| IUPAC Name | 7-methoxy-4-tri(propan-2-yl)silyloxy-1,3-benzodioxole-5-carbaldehyde |
| SMILES | COc1cc(C=O)c(O[Si](C(C)C)(C(C)C)C(C)C)c2c1OCO2 |
| InChI | InChI=1S/C18H28O5Si/c1-11(2)24(12(3)4,13(5)6)23-16-14(9-19)8-15(20-7)17-18(16)22-10-21-17/h8-9,11-13H,10H2,1-7H3 |
| InChIKey | HUJAHHLDSROZNC-UHFFFAOYSA-N |
| XLogP | 4.79 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.50 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|