C23H34ClNSi — CID 142472984
2-[1-[2-tri(propan-2-yl)silylethynyl]naphthalen-2-yl]ethanamine;hydrochloride (PubChem CID 142472984) has the molecular formula C23H34ClNSi and a molecular weight of 388.07 g/mol. Its IUPAC name is 2-[1-[2-tri(propan-2-yl)silylethynyl]naphthalen-2-yl]ethanamine;hydrochloride.
| Compound Name | 2-[1-[2-tri(propan-2-yl)silylethynyl]naphthalen-2-yl]ethanamine;hydrochloride |
|---|---|
| PubChem CID | 142472984 |
| Molecular Formula | C23H34ClNSi |
| Molecular Weight | 388.07 g/mol |
| Exact Mass | 387.21 |
| IUPAC Name | 2-[1-[2-tri(propan-2-yl)silylethynyl]naphthalen-2-yl]ethanamine;hydrochloride |
| SMILES | CC(C)[Si](C#Cc1c(CCN)ccc2ccccc12)(C(C)C)C(C)C.Cl |
| InChI | InChI=1S/C23H33NSi.ClH/c1-17(2)25(18(3)4,19(5)6)16-14-23-21(13-15-24)12-11-20-9-7-8-10-22(20)23;/h7-12,17-19H,13,15,24H2,1-6H3;1H |
| InChIKey | CCLGDRRHGPUORY-UHFFFAOYSA-N |
| XLogP | 6.33 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.07 |
| LogP ≤ 5 | 6.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|