C27H39BO2Si — CID 138979325
[5-(3-tert-butylphenyl)-2-[2-tri(propan-2-yl)silylethynyl]phenyl]boronic acid (PubChem CID 138979325) has the molecular formula C27H39BO2Si and a molecular weight of 434.51 g/mol. Its IUPAC name is [5-(3-tert-butylphenyl)-2-[2-tri(propan-2-yl)silylethynyl]phenyl]boronic acid.
| Compound Name | [5-(3-tert-butylphenyl)-2-[2-tri(propan-2-yl)silylethynyl]phenyl]boronic acid |
|---|---|
| PubChem CID | 138979325 |
| Molecular Formula | C27H39BO2Si |
| Molecular Weight | 434.51 g/mol |
| Exact Mass | 434.28 |
| IUPAC Name | [5-(3-tert-butylphenyl)-2-[2-tri(propan-2-yl)silylethynyl]phenyl]boronic acid |
| SMILES | CC(C)[Si](C#Cc1ccc(-c2cccc(C(C)(C)C)c2)cc1B(O)O)(C(C)C)C(C)C |
| InChI | InChI=1S/C27H39BO2Si/c1-19(2)31(20(3)4,21(5)6)16-15-22-13-14-24(18-26(22)28(29)30)23-11-10-12-25(17-23)27(7,8)9/h10-14,17-21,29-30H,1-9H3 |
| InChIKey | DFDYUCVSCBZQLP-UHFFFAOYSA-N |
| XLogP | 5.90 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.51 |
| LogP ≤ 5 | 5.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|