C30H26O4 — CID 19991312
9,18-bis(2-methylpropoxy)hexacyclo[11.7.1.14,20.02,11.03,8.017,21]docosa-1(21),2,4,6,8,10,13,15,17,19-decaene-12,22-dione (PubChem CID 19991312) has the molecular formula C30H26O4 and a molecular weight of 450.53 g/mol. Its IUPAC name is 9,18-bis(2-methylpropoxy)hexacyclo[11.7.1.14,20.02,11.03,8.017,21]docosa-1(21),2,4,6,8,10,13,15,17,19-decaene-12,22-dione.
| Compound Name | 9,18-bis(2-methylpropoxy)hexacyclo[11.7.1.14,20.02,11.03,8.017,21]docosa-1(21),2,4,6,8,10,13,15,17,19-decaene-12,22-dione |
|---|---|
| PubChem CID | 19991312 |
| Molecular Formula | C30H26O4 |
| Molecular Weight | 450.53 g/mol |
| Exact Mass | 450.18 |
| IUPAC Name | 9,18-bis(2-methylpropoxy)hexacyclo[11.7.1.14,20.02,11.03,8.017,21]docosa-1(21),2,4,6,8,10,13,15,17,19-decaene-12,22-dione |
| SMILES | CC(C)COc1cc2c3c4c1cccc4c(=O)c1cc(OCC(C)C)c4cccc(c2=O)c4c1-3 |
| InChI | InChI=1S/C30H26O4/c1-15(2)13-33-23-11-21-27-25-17(23)7-5-9-19(25)30(32)22-12-24(34-14-16(3)4)18-8-6-10-20(29(21)31)26(18)28(22)27/h5-12,15-16H,13-14H2,1-4H3 |
| InChIKey | QSIYKMJQKUNFEV-UHFFFAOYSA-N |
| XLogP | 6.51 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.53 |
| LogP ≤ 5 | 6.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|