C18H8Br2 — CID 71401703
1,8-bis(2-bromoethynyl)anthracene (PubChem CID 71401703) has the molecular formula C18H8Br2 and a molecular weight of 384.07 g/mol. Its IUPAC name is 1,8-bis(2-bromoethynyl)anthracene.
| Compound Name | 1,8-bis(2-bromoethynyl)anthracene |
|---|---|
| PubChem CID | 71401703 |
| Molecular Formula | C18H8Br2 |
| Molecular Weight | 384.07 g/mol |
| Exact Mass | 381.90 |
| IUPAC Name | 1,8-bis(2-bromoethynyl)anthracene |
| SMILES | BrC#Cc1cccc2cc3cccc(C#CBr)c3cc12 |
| InChI | InChI=1S/C18H8Br2/c19-9-7-13-3-1-5-15-11-16-6-2-4-14(8-10-20)18(16)12-17(13)15/h1-6,11-12H |
| InChIKey | WFUROLPAVDZASM-UHFFFAOYSA-N |
| XLogP | 5.40 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.07 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|