C36H38O4S2 — CID 102470652
S-[4-[2-[4-[2-(4-acetylsulfanylphenyl)ethynyl]-2,5-bis(3-methylbutoxy)phenyl]ethynyl]phenyl] ethanethioate (PubChem CID 102470652) has the molecular formula C36H38O4S2 and a molecular weight of 598.83 g/mol. Its IUPAC name is S-[4-[2-[4-[2-(4-acetylsulfanylphenyl)ethynyl]-2,5-bis(3-methylbutoxy)phenyl]ethynyl]phenyl] ethanethioate.
| Compound Name | S-[4-[2-[4-[2-(4-acetylsulfanylphenyl)ethynyl]-2,5-bis(3-methylbutoxy)phenyl]ethynyl]phenyl] ethanethioate |
|---|---|
| PubChem CID | 102470652 |
| Molecular Formula | C36H38O4S2 |
| Molecular Weight | 598.83 g/mol |
| Exact Mass | 598.22 |
| IUPAC Name | S-[4-[2-[4-[2-(4-acetylsulfanylphenyl)ethynyl]-2,5-bis(3-methylbutoxy)phenyl]ethynyl]phenyl] ethanethioate |
| SMILES | CC(=O)Sc1ccc(C#Cc2cc(OCCC(C)C)c(C#Cc3ccc(SC(C)=O)cc3)cc2OCCC(C)C)cc1 |
| InChI | InChI=1S/C36H38O4S2/c1-25(2)19-21-39-35-23-32(14-8-30-11-17-34(18-12-30)42-28(6)38)36(40-22-20-26(3)4)24-31(35)13-7-29-9-15-33(16-10-29)41-27(5)37/h9-12,15-18,23-26H,19-22H2,1-6H3 |
| InChIKey | OPADICWKVJAULE-UHFFFAOYSA-N |
| XLogP | 8.61 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 598.83 |
| LogP ≤ 5 | 8.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|