C26H20FeOS — CID 158336687
cyclopenta-1,3-diene;S-[4-[2-(4-cyclopenta-2,4-dien-1-ylphenyl)ethynyl]phenyl] ethanethioate;iron(2+) (PubChem CID 158336687) has the molecular formula C26H20FeOS and a molecular weight of 436.36 g/mol. Its IUPAC name is cyclopenta-1,3-diene;S-[4-[2-(4-cyclopenta-2,4-dien-1-ylphenyl)ethynyl]phenyl] ethanethioate;iron(2+).
| Compound Name | cyclopenta-1,3-diene;S-[4-[2-(4-cyclopenta-2,4-dien-1-ylphenyl)ethynyl]phenyl] ethanethioate;iron(2+) |
|---|---|
| PubChem CID | 158336687 |
| Molecular Formula | C26H20FeOS |
| Molecular Weight | 436.36 g/mol |
| Exact Mass | 436.06 |
| IUPAC Name | cyclopenta-1,3-diene;S-[4-[2-(4-cyclopenta-2,4-dien-1-ylphenyl)ethynyl]phenyl] ethanethioate;iron(2+) |
| SMILES | CC(=O)Sc1ccc(C#Cc2ccc(-[c-]3cccc3)cc2)cc1.[Fe+2].c1cc[cH-]c1 |
| InChI | InChI=1S/C21H15OS.C5H5.Fe/c1-16(22)23-21-14-10-18(11-15-21)7-6-17-8-12-20(13-9-17)19-4-2-3-5-19;1-2-4-5-3-1;/h2-5,8-15H,1H3;1-5H;/q2*-1;+2 |
| InChIKey | GQQZDMZVXIHHEW-UHFFFAOYSA-N |
| XLogP | 6.51 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.36 |
| LogP ≤ 5 | 6.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|