C29H29N — CID 134873256
(3E,5Z)-N-tert-butyl-2,4,6-triphenylhepta-1,3,5-trien-1-imine (PubChem CID 134873256) has the molecular formula C29H29N and a molecular weight of 391.56 g/mol. Its IUPAC name is (3E,5Z)-N-tert-butyl-2,4,6-triphenylhepta-1,3,5-trien-1-imine.
| Compound Name | (3E,5Z)-N-tert-butyl-2,4,6-triphenylhepta-1,3,5-trien-1-imine |
|---|---|
| PubChem CID | 134873256 |
| Molecular Formula | C29H29N |
| Molecular Weight | 391.56 g/mol |
| Exact Mass | 391.23 |
| IUPAC Name | (3E,5Z)-N-tert-butyl-2,4,6-triphenylhepta-1,3,5-trien-1-imine |
| SMILES | C/C(=C/C(=C\C(=C=NC(C)(C)C)c1ccccc1)c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C29H29N/c1-23(24-14-8-5-9-15-24)20-27(25-16-10-6-11-17-25)21-28(22-30-29(2,3)4)26-18-12-7-13-19-26/h5-21H,1-4H3/b23-20-,27-21+ |
| InChIKey | AJYDKCORFCWFIF-XSBZQNGPSA-N |
| XLogP | 7.73 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.56 |
| LogP ≤ 5 | 7.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|