C29H42N2O4 — CID 10552820
(E)-3-[4-[[4-[(E)-1-carboxylatoprop-1-en-2-yl]phenyl]methyl]phenyl]but-2-enoate;bis(tetramethylazanium) (PubChem CID 10552820) has the molecular formula C29H42N2O4 and a molecular weight of 482.67 g/mol. Its IUPAC name is (E)-3-[4-[[4-[(E)-1-carboxylatoprop-1-en-2-yl]phenyl]methyl]phenyl]but-2-enoate;bis(tetramethylazanium).
| Compound Name | (E)-3-[4-[[4-[(E)-1-carboxylatoprop-1-en-2-yl]phenyl]methyl]phenyl]but-2-enoate;bis(tetramethylazanium) |
|---|---|
| PubChem CID | 10552820 |
| Molecular Formula | C29H42N2O4 |
| Molecular Weight | 482.67 g/mol |
| Exact Mass | 482.31 |
| IUPAC Name | (E)-3-[4-[[4-[(E)-1-carboxylatoprop-1-en-2-yl]phenyl]methyl]phenyl]but-2-enoate;bis(tetramethylazanium) |
| SMILES | C/C(=C\C(=O)[O-])c1ccc(Cc2ccc(/C(C)=C/C(=O)[O-])cc2)cc1.C[N+](C)(C)C.C[N+](C)(C)C |
| InChI | InChI=1S/C21H20O4.2C4H12N/c1-14(11-20(22)23)18-7-3-16(4-8-18)13-17-5-9-19(10-6-17)15(2)12-21(24)25;2*1-5(2,3)4/h3-12H,13H2,1-2H3,(H,22,23)(H,24,25);2*1-4H3/q;2*+1/p-2/b14-11+,15-12+;; |
| InChIKey | LDGLIRQASBWELR-FDZRARIRSA-L |
| XLogP | 2.23 |
| TPSA | 80.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.67 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|