About 3-amino-2-ethylbenzamide;dihydrochloride
3-amino-2-ethylbenzamide;dihydrochloride (PubChem CID 174785201) has the molecular formula C9H14Cl2N2O
and a molecular weight of 237.13 g/mol. Its IUPAC name is 3-amino-2-ethylbenzamide;dihydrochloride.
Molecular Properties
| Compound Name | 3-amino-2-ethylbenzamide;dihydrochloride |
| PubChem CID | 174785201 |
| Molecular Formula | C9H14Cl2N2O |
| Molecular Weight | 237.13 g/mol |
| Exact Mass | 236.05 |
| IUPAC Name | 3-amino-2-ethylbenzamide;dihydrochloride |
| SMILES | CCc1c(N)cccc1C(N)=O.Cl.Cl |
| InChI | InChI=1S/C9H12N2O.2ClH/c1-2-6-7(9(11)12)4-3-5-8(6)10;;/h3-5H,2,10H2,1H3,(H2,11,12);2*1H |
| InChIKey | SEILYSHXNPUQOI-UHFFFAOYSA-N |
| XLogP | 1.77 |
| TPSA | 69.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 237.13 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 3-amino-2-ethylbenzamide;dihydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-amino-2-ethylbenzamide;dihydrochloride?
The IUPAC name of 3-amino-2-ethylbenzamide;dihydrochloride (CID 174785201) is 3-amino-2-ethylbenzamide;dihydrochloride.
What is the SMILES notation for 3-amino-2-ethylbenzamide;dihydrochloride?
The canonical SMILES for 3-amino-2-ethylbenzamide;dihydrochloride is CCc1c(N)cccc1C(N)=O.Cl.Cl.
What is the InChIKey of 3-amino-2-ethylbenzamide;dihydrochloride?
The InChIKey is SEILYSHXNPUQOI-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H12N2O.2ClH/c1-2-6-7(9(11)12)4-3-5-8(6)10;;/h3-5H,2,10H2,1H3,(H2,11,12);2*1H.
What are the key properties of 3-amino-2-ethylbenzamide;dihydrochloride?
3-amino-2-ethylbenzamide;dihydrochloride has a molecular weight of 237.13 g/mol, XLogP of 1.77, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-amino-2-ethylbenzamide;dihydrochloride is sourced from PubChem (CID 174785201), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).