C10H10FNO5 — CID 174895281
2-fluoro-4-methylbenzene-1,3-dicarboxylic acid;formamide (PubChem CID 174895281) has the molecular formula C10H10FNO5 and a molecular weight of 243.19 g/mol. Its IUPAC name is 2-fluoro-4-methylbenzene-1,3-dicarboxylic acid;formamide.
| Compound Name | 2-fluoro-4-methylbenzene-1,3-dicarboxylic acid;formamide |
|---|---|
| PubChem CID | 174895281 |
| Molecular Formula | C10H10FNO5 |
| Molecular Weight | 243.19 g/mol |
| Exact Mass | 243.05 |
| IUPAC Name | 2-fluoro-4-methylbenzene-1,3-dicarboxylic acid;formamide |
| SMILES | Cc1ccc(C(=O)O)c(F)c1C(=O)O.NC=O |
| InChI | InChI=1S/C9H7FO4.CH3NO/c1-4-2-3-5(8(11)12)7(10)6(4)9(13)14;2-1-3/h2-3H,1H3,(H,11,12)(H,13,14);1H,(H2,2,3) |
| InChIKey | XICRNLIAUKHWOY-UHFFFAOYSA-N |
| XLogP | 0.63 |
| TPSA | 117.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.19 |
| LogP ≤ 5 | 0.63 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|