C9H7ClF2O3S — CID 142726852
4-[chloro(difluoro)methyl]-2-hydroxy-3-methylsulfanylbenzoic acid (PubChem CID 142726852) has the molecular formula C9H7ClF2O3S and a molecular weight of 268.67 g/mol. Its IUPAC name is 4-[chloro(difluoro)methyl]-2-hydroxy-3-methylsulfanylbenzoic acid.
| Compound Name | 4-[chloro(difluoro)methyl]-2-hydroxy-3-methylsulfanylbenzoic acid |
|---|---|
| PubChem CID | 142726852 |
| Molecular Formula | C9H7ClF2O3S |
| Molecular Weight | 268.67 g/mol |
| Exact Mass | 267.98 |
| IUPAC Name | 4-[chloro(difluoro)methyl]-2-hydroxy-3-methylsulfanylbenzoic acid |
| SMILES | CSc1c(C(F)(F)Cl)ccc(C(=O)O)c1O |
| InChI | InChI=1S/C9H7ClF2O3S/c1-16-7-5(9(10,11)12)3-2-4(6(7)13)8(14)15/h2-3,13H,1H3,(H,14,15) |
| InChIKey | CVSJSVRABQTBLS-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.67 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|