C11H11Cl3O2S — CID 125497287
3-ethylsulfanyl-2-methyl-4-(trichloromethyl)benzoic acid (PubChem CID 125497287) has the molecular formula C11H11Cl3O2S and a molecular weight of 313.63 g/mol. Its IUPAC name is 3-ethylsulfanyl-2-methyl-4-(trichloromethyl)benzoic acid.
| Compound Name | 3-ethylsulfanyl-2-methyl-4-(trichloromethyl)benzoic acid |
|---|---|
| PubChem CID | 125497287 |
| Molecular Formula | C11H11Cl3O2S |
| Molecular Weight | 313.63 g/mol |
| Exact Mass | 311.95 |
| IUPAC Name | 3-ethylsulfanyl-2-methyl-4-(trichloromethyl)benzoic acid |
| SMILES | CCSc1c(C(Cl)(Cl)Cl)ccc(C(=O)O)c1C |
| InChI | InChI=1S/C11H11Cl3O2S/c1-3-17-9-6(2)7(10(15)16)4-5-8(9)11(12,13)14/h4-5H,3H2,1-2H3,(H,15,16) |
| InChIKey | ZKWCVFGLRKUDRX-UHFFFAOYSA-N |
| XLogP | 4.63 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.63 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|