C12H13Cl3O4S — CID 125496858
2-ethyl-3-ethylsulfonyl-4-(trichloromethyl)benzoic acid (PubChem CID 125496858) has the molecular formula C12H13Cl3O4S and a molecular weight of 359.66 g/mol. Its IUPAC name is 2-ethyl-3-ethylsulfonyl-4-(trichloromethyl)benzoic acid.
| Compound Name | 2-ethyl-3-ethylsulfonyl-4-(trichloromethyl)benzoic acid |
|---|---|
| PubChem CID | 125496858 |
| Molecular Formula | C12H13Cl3O4S |
| Molecular Weight | 359.66 g/mol |
| Exact Mass | 357.96 |
| IUPAC Name | 2-ethyl-3-ethylsulfonyl-4-(trichloromethyl)benzoic acid |
| SMILES | CCc1c(C(=O)O)ccc(C(Cl)(Cl)Cl)c1S(=O)(=O)CC |
| InChI | InChI=1S/C12H13Cl3O4S/c1-3-7-8(11(16)17)5-6-9(12(13,14)15)10(7)20(18,19)4-2/h5-6H,3-4H2,1-2H3,(H,16,17) |
| InChIKey | LMXXRDGCOSSJRJ-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 71.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.66 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|