C15H17F5O4S — CID 125497241
2-ethyl-3-(2-methylpropylsulfonyl)-4-(1,1,2,2,2-pentafluoroethyl)benzoic acid (PubChem CID 125497241) has the molecular formula C15H17F5O4S and a molecular weight of 388.35 g/mol. Its IUPAC name is 2-ethyl-3-(2-methylpropylsulfonyl)-4-(1,1,2,2,2-pentafluoroethyl)benzoic acid.
| Compound Name | 2-ethyl-3-(2-methylpropylsulfonyl)-4-(1,1,2,2,2-pentafluoroethyl)benzoic acid |
|---|---|
| PubChem CID | 125497241 |
| Molecular Formula | C15H17F5O4S |
| Molecular Weight | 388.35 g/mol |
| Exact Mass | 388.08 |
| IUPAC Name | 2-ethyl-3-(2-methylpropylsulfonyl)-4-(1,1,2,2,2-pentafluoroethyl)benzoic acid |
| SMILES | CCc1c(C(=O)O)ccc(C(F)(F)C(F)(F)F)c1S(=O)(=O)CC(C)C |
| InChI | InChI=1S/C15H17F5O4S/c1-4-9-10(13(21)22)5-6-11(14(16,17)15(18,19)20)12(9)25(23,24)7-8(2)3/h5-6,8H,4,7H2,1-3H3,(H,21,22) |
| InChIKey | XFUMXQRYHQPQNE-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 71.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.35 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|