C16H17F7O3S — CID 125496669
3-[(R)-[(2S)-butan-2-yl]sulfinyl]-2-ethyl-4-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)benzoic acid (PubChem CID 125496669) has the molecular formula C16H17F7O3S and a molecular weight of 422.36 g/mol. Its IUPAC name is 3-[(R)-[(2S)-butan-2-yl]sulfinyl]-2-ethyl-4-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)benzoic acid.
| Compound Name | 3-[(R)-[(2S)-butan-2-yl]sulfinyl]-2-ethyl-4-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)benzoic acid |
|---|---|
| PubChem CID | 125496669 |
| Molecular Formula | C16H17F7O3S |
| Molecular Weight | 422.36 g/mol |
| Exact Mass | 422.08 |
| IUPAC Name | 3-[(R)-[(2S)-butan-2-yl]sulfinyl]-2-ethyl-4-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)benzoic acid |
| SMILES | CCc1c(C(=O)O)ccc(C(F)(C(F)(F)F)C(F)(F)F)c1[S@](=O)[C@@H](C)CC |
| InChI | InChI=1S/C16H17F7O3S/c1-4-8(3)27(26)12-9(5-2)10(13(24)25)6-7-11(12)14(17,15(18,19)20)16(21,22)23/h6-8H,4-5H2,1-3H3,(H,24,25)/t8-,27+/m0/s1 |
| InChIKey | FIOBMHPGQOLBAX-UQTVHIPJSA-N |
| XLogP | 5.14 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.36 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |