C15H15F7O3S — CID 125496904
3-[(R)-butylsulfinyl]-4-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-2-methylbenzoic acid (PubChem CID 125496904) has the molecular formula C15H15F7O3S and a molecular weight of 408.34 g/mol. Its IUPAC name is 3-[(R)-butylsulfinyl]-4-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-2-methylbenzoic acid.
| Compound Name | 3-[(R)-butylsulfinyl]-4-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-2-methylbenzoic acid |
|---|---|
| PubChem CID | 125496904 |
| Molecular Formula | C15H15F7O3S |
| Molecular Weight | 408.34 g/mol |
| Exact Mass | 408.06 |
| IUPAC Name | 3-[(R)-butylsulfinyl]-4-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-2-methylbenzoic acid |
| SMILES | CCCC[S@@](=O)c1c(C(F)(C(F)(F)F)C(F)(F)F)ccc(C(=O)O)c1C |
| InChI | InChI=1S/C15H15F7O3S/c1-3-4-7-26(25)11-8(2)9(12(23)24)5-6-10(11)13(16,14(17,18)19)15(20,21)22/h5-6H,3-4,7H2,1-2H3,(H,23,24)/t26-/m1/s1 |
| InChIKey | NOCFTMQAASCYOT-AREMUKBSSA-N |
| XLogP | 4.89 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.34 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |