C14H17Cl3O3S — CID 125496790
3-[(R)-[(2R)-butan-2-yl]sulfinyl]-2-ethyl-4-(trichloromethyl)benzoic acid (PubChem CID 125496790) has the molecular formula C14H17Cl3O3S and a molecular weight of 371.71 g/mol. Its IUPAC name is 3-[(R)-[(2R)-butan-2-yl]sulfinyl]-2-ethyl-4-(trichloromethyl)benzoic acid.
| Compound Name | 3-[(R)-[(2R)-butan-2-yl]sulfinyl]-2-ethyl-4-(trichloromethyl)benzoic acid |
|---|---|
| PubChem CID | 125496790 |
| Molecular Formula | C14H17Cl3O3S |
| Molecular Weight | 371.71 g/mol |
| Exact Mass | 370.00 |
| IUPAC Name | 3-[(R)-[(2R)-butan-2-yl]sulfinyl]-2-ethyl-4-(trichloromethyl)benzoic acid |
| SMILES | CCc1c(C(=O)O)ccc(C(Cl)(Cl)Cl)c1[S@](=O)[C@H](C)CC |
| InChI | InChI=1S/C14H17Cl3O3S/c1-4-8(3)21(20)12-9(5-2)10(13(18)19)6-7-11(12)14(15,16)17/h6-8H,4-5H2,1-3H3,(H,18,19)/t8-,21-/m1/s1 |
| InChIKey | IRDLVFASTNUNEV-IJSAXESFSA-N |
| XLogP | 4.68 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.71 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|