C12H16O4S — CID 125468470
2,4-diethyl-3-methylsulfonylbenzoic acid (PubChem CID 125468470) has the molecular formula C12H16O4S and a molecular weight of 256.32 g/mol. Its IUPAC name is 2,4-diethyl-3-methylsulfonylbenzoic acid.
| Compound Name | 2,4-diethyl-3-methylsulfonylbenzoic acid |
|---|---|
| PubChem CID | 125468470 |
| Molecular Formula | C12H16O4S |
| Molecular Weight | 256.32 g/mol |
| Exact Mass | 256.08 |
| IUPAC Name | 2,4-diethyl-3-methylsulfonylbenzoic acid |
| SMILES | CCc1ccc(C(=O)O)c(CC)c1S(C)(=O)=O |
| InChI | InChI=1S/C12H16O4S/c1-4-8-6-7-10(12(13)14)9(5-2)11(8)17(3,15)16/h6-7H,4-5H2,1-3H3,(H,13,14) |
| InChIKey | VVFNBHHPLWRHNU-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 71.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.32 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |