4-(diethylamino)-2-methylbenzene-1,3-dicarboxylic acid

C13H17NO4 — CID 174661599

IUPAC4-(diethylamino)-2-methylbenzene-1,3-dicarboxylic acid
SMILESCCN(CC)c1ccc(C(=O)O)c(C)c1C(=O)O
InChIInChI=1S/C13H17NO4/c1-4-14(5-2)10-7-6-9(12(15)16)8(3)11(10)13(17)18/h6-7H,4-5H2,1-3H3,(H,15,16)(H,17,18)
InChIKeyMQNJBHRXFJSBDP-UHFFFAOYSA-N
MW251.28 g/mol
LogP2.24
Rot. Bonds5

About 4-(diethylamino)-2-methylbenzene-1,3-dicarboxylic acid

4-(diethylamino)-2-methylbenzene-1,3-dicarboxylic acid (PubChem CID 174661599) has the molecular formula C13H17NO4 and a molecular weight of 251.28 g/mol. Its IUPAC name is 4-(diethylamino)-2-methylbenzene-1,3-dicarboxylic acid.

Molecular Properties

Compound Name4-(diethylamino)-2-methylbenzene-1,3-dicarboxylic acid
PubChem CID174661599
Molecular FormulaC13H17NO4
Molecular Weight251.28 g/mol
Exact Mass251.12
IUPAC Name4-(diethylamino)-2-methylbenzene-1,3-dicarboxylic acid
SMILESCCN(CC)c1ccc(C(=O)O)c(C)c1C(=O)O
InChIInChI=1S/C13H17NO4/c1-4-14(5-2)10-7-6-9(12(15)16)8(3)11(10)13(17)18/h6-7H,4-5H2,1-3H3,(H,15,16)(H,17,18)
InChIKeyMQNJBHRXFJSBDP-UHFFFAOYSA-N
XLogP2.24
TPSA77.84 Ų
H-Bond Donors2
H-Bond Acceptors3
Rotatable Bonds5
Heavy Atoms18
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500251.28
LogP ≤ 52.24
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 103

Analyze 4-(diethylamino)-2-methylbenzene-1,3-dicarboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 4-(diethylamino)-2-methylbenzene-1,3-dicarboxylic acid?
The IUPAC name of 4-(diethylamino)-2-methylbenzene-1,3-dicarboxylic acid (CID 174661599) is 4-(diethylamino)-2-methylbenzene-1,3-dicarboxylic acid.
What is the SMILES notation for 4-(diethylamino)-2-methylbenzene-1,3-dicarboxylic acid?
The canonical SMILES for 4-(diethylamino)-2-methylbenzene-1,3-dicarboxylic acid is CCN(CC)c1ccc(C(=O)O)c(C)c1C(=O)O.
What is the InChIKey of 4-(diethylamino)-2-methylbenzene-1,3-dicarboxylic acid?
The InChIKey is MQNJBHRXFJSBDP-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H17NO4/c1-4-14(5-2)10-7-6-9(12(15)16)8(3)11(10)13(17)18/h6-7H,4-5H2,1-3H3,(H,15,16)(H,17,18).
What are the key properties of 4-(diethylamino)-2-methylbenzene-1,3-dicarboxylic acid?
4-(diethylamino)-2-methylbenzene-1,3-dicarboxylic acid has a molecular weight of 251.28 g/mol, XLogP of 2.24, 5 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(diethylamino)-2-methylbenzene-1,3-dicarboxylic acid is sourced from PubChem (CID 174661599), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).