C11H9F5O2 — CID 175420502
2-[2-(difluoromethyl)-6-(trifluoromethyl)phenyl]propanoic acid (PubChem CID 175420502) has the molecular formula C11H9F5O2 and a molecular weight of 268.18 g/mol. Its IUPAC name is 2-[2-(difluoromethyl)-6-(trifluoromethyl)phenyl]propanoic acid.
| Compound Name | 2-[2-(difluoromethyl)-6-(trifluoromethyl)phenyl]propanoic acid |
|---|---|
| PubChem CID | 175420502 |
| Molecular Formula | C11H9F5O2 |
| Molecular Weight | 268.18 g/mol |
| Exact Mass | 268.05 |
| IUPAC Name | 2-[2-(difluoromethyl)-6-(trifluoromethyl)phenyl]propanoic acid |
| SMILES | CC(C(=O)O)c1c(C(F)F)cccc1C(F)(F)F |
| InChI | InChI=1S/C11H9F5O2/c1-5(10(17)18)8-6(9(12)13)3-2-4-7(8)11(14,15)16/h2-5,9H,1H3,(H,17,18) |
| InChIKey | MEFDRPTUWUEAAN-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.18 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |