C10H9F3O4 — CID 117378281
2-[2,3-dihydroxy-6-(trifluoromethyl)phenyl]propanoic acid (PubChem CID 117378281) has the molecular formula C10H9F3O4 and a molecular weight of 250.17 g/mol. Its IUPAC name is 2-[2,3-dihydroxy-6-(trifluoromethyl)phenyl]propanoic acid.
| Compound Name | 2-[2,3-dihydroxy-6-(trifluoromethyl)phenyl]propanoic acid |
|---|---|
| PubChem CID | 117378281 |
| Molecular Formula | C10H9F3O4 |
| Molecular Weight | 250.17 g/mol |
| Exact Mass | 250.05 |
| IUPAC Name | 2-[2,3-dihydroxy-6-(trifluoromethyl)phenyl]propanoic acid |
| SMILES | CC(C(=O)O)c1c(C(F)(F)F)ccc(O)c1O |
| InChI | InChI=1S/C10H9F3O4/c1-4(9(16)17)7-5(10(11,12)13)2-3-6(14)8(7)15/h2-4,14-15H,1H3,(H,16,17) |
| InChIKey | DRPWZWPFJDKPIT-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 77.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.17 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|