C8H9Cl4N — CID 171233500
(1S)-1-(2,3,5-trichlorophenyl)ethanamine;hydrochloride (PubChem CID 171233500) has the molecular formula C8H9Cl4N and a molecular weight of 260.98 g/mol. Its IUPAC name is (1S)-1-(2,3,5-trichlorophenyl)ethanamine;hydrochloride.
| Compound Name | (1S)-1-(2,3,5-trichlorophenyl)ethanamine;hydrochloride |
|---|---|
| PubChem CID | 171233500 |
| Molecular Formula | C8H9Cl4N |
| Molecular Weight | 260.98 g/mol |
| Exact Mass | 258.95 |
| IUPAC Name | (1S)-1-(2,3,5-trichlorophenyl)ethanamine;hydrochloride |
| SMILES | C[C@H](N)c1cc(Cl)cc(Cl)c1Cl.Cl |
| InChI | InChI=1S/C8H8Cl3N.ClH/c1-4(12)6-2-5(9)3-7(10)8(6)11;/h2-4H,12H2,1H3;1H/t4-;/m0./s1 |
| InChIKey | YFLTUIHUGZETGW-WCCKRBBISA-N |
| XLogP | 4.09 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.98 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|