C9H13O2P — CID 174913168
phosphenous acid;1,2,3-trimethylbenzene (PubChem CID 174913168) has the molecular formula C9H13O2P and a molecular weight of 184.17 g/mol. Its IUPAC name is phosphenous acid;1,2,3-trimethylbenzene.
| Compound Name | phosphenous acid;1,2,3-trimethylbenzene |
|---|---|
| PubChem CID | 174913168 |
| Molecular Formula | C9H13O2P |
| Molecular Weight | 184.17 g/mol |
| Exact Mass | 184.07 |
| IUPAC Name | phosphenous acid;1,2,3-trimethylbenzene |
| SMILES | Cc1cccc(C)c1C.O=PO |
| InChI | InChI=1S/C9H12.HO2P/c1-7-5-4-6-8(2)9(7)3;1-3-2/h4-6H,1-3H3;(H,1,2) |
| InChIKey | NKINEVHWKYTLBB-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 184.17 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|