C22H26N2 — CID 70576853
N-benzyl-1-phenylmethanamine;2,3-dimethylaniline (PubChem CID 70576853) has the molecular formula C22H26N2 and a molecular weight of 318.46 g/mol. Its IUPAC name is N-benzyl-1-phenylmethanamine;2,3-dimethylaniline.
| Compound Name | N-benzyl-1-phenylmethanamine;2,3-dimethylaniline |
|---|---|
| PubChem CID | 70576853 |
| Molecular Formula | C22H26N2 |
| Molecular Weight | 318.46 g/mol |
| Exact Mass | 318.21 |
| IUPAC Name | N-benzyl-1-phenylmethanamine;2,3-dimethylaniline |
| SMILES | Cc1cccc(N)c1C.c1ccc(CNCc2ccccc2)cc1 |
| InChI | InChI=1S/C14H15N.C8H11N/c1-3-7-13(8-4-1)11-15-12-14-9-5-2-6-10-14;1-6-4-3-5-8(9)7(6)2/h1-10,15H,11-12H2;3-5H,9H2,1-2H3 |
| InChIKey | ARVVGWWDVLVFQF-UHFFFAOYSA-N |
| XLogP | 4.86 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.46 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|