C13H18N2O5 — CID 5210710
N'-(3,4-dimethoxyphenyl)-N-(3-hydroxypropyl)oxamide (PubChem CID 5210710) has the molecular formula C13H18N2O5 and a molecular weight of 282.30 g/mol. Its IUPAC name is N'-(3,4-dimethoxyphenyl)-N-(3-hydroxypropyl)oxamide.
| Compound Name | N'-(3,4-dimethoxyphenyl)-N-(3-hydroxypropyl)oxamide |
|---|---|
| PubChem CID | 5210710 |
| Molecular Formula | C13H18N2O5 |
| Molecular Weight | 282.30 g/mol |
| Exact Mass | 282.12 |
| IUPAC Name | N'-(3,4-dimethoxyphenyl)-N-(3-hydroxypropyl)oxamide |
| SMILES | COc1ccc(NC(=O)C(=O)NCCCO)cc1OC |
| InChI | InChI=1S/C13H18N2O5/c1-19-10-5-4-9(8-11(10)20-2)15-13(18)12(17)14-6-3-7-16/h4-5,8,16H,3,6-7H2,1-2H3,(H,14,17)(H,15,18) |
| InChIKey | UWUVVIRVTZXZAL-UHFFFAOYSA-N |
| XLogP | 0.14 |
| TPSA | 96.89 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.30 |
| LogP ≤ 5 | 0.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|