C12H15FN2O3 — CID 110933503
N'-(4-fluoro-3-methylphenyl)-N-(3-hydroxypropyl)oxamide (PubChem CID 110933503) has the molecular formula C12H15FN2O3 and a molecular weight of 254.26 g/mol. Its IUPAC name is N'-(4-fluoro-3-methylphenyl)-N-(3-hydroxypropyl)oxamide.
| Compound Name | N'-(4-fluoro-3-methylphenyl)-N-(3-hydroxypropyl)oxamide |
|---|---|
| PubChem CID | 110933503 |
| Molecular Formula | C12H15FN2O3 |
| Molecular Weight | 254.26 g/mol |
| Exact Mass | 254.11 |
| IUPAC Name | N'-(4-fluoro-3-methylphenyl)-N-(3-hydroxypropyl)oxamide |
| SMILES | Cc1cc(NC(=O)C(=O)NCCCO)ccc1F |
| InChI | InChI=1S/C12H15FN2O3/c1-8-7-9(3-4-10(8)13)15-12(18)11(17)14-5-2-6-16/h3-4,7,16H,2,5-6H2,1H3,(H,14,17)(H,15,18) |
| InChIKey | ZQQVRMSZQOLUJS-UHFFFAOYSA-N |
| XLogP | 0.57 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.26 |
| LogP ≤ 5 | 0.57 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|