C23H29N3O4 — CID 16892103
N'-(3,4-dimethoxyphenyl)-N-[3-(4-pyrrolidin-1-ylphenyl)propyl]oxamide (PubChem CID 16892103) has the molecular formula C23H29N3O4 and a molecular weight of 411.50 g/mol. Its IUPAC name is N'-(3,4-dimethoxyphenyl)-N-[3-(4-pyrrolidin-1-ylphenyl)propyl]oxamide.
| Compound Name | N'-(3,4-dimethoxyphenyl)-N-[3-(4-pyrrolidin-1-ylphenyl)propyl]oxamide |
|---|---|
| PubChem CID | 16892103 |
| Molecular Formula | C23H29N3O4 |
| Molecular Weight | 411.50 g/mol |
| Exact Mass | 411.22 |
| IUPAC Name | N'-(3,4-dimethoxyphenyl)-N-[3-(4-pyrrolidin-1-ylphenyl)propyl]oxamide |
| SMILES | COc1ccc(NC(=O)C(=O)NCCCc2ccc(N3CCCC3)cc2)cc1OC |
| InChI | InChI=1S/C23H29N3O4/c1-29-20-12-9-18(16-21(20)30-2)25-23(28)22(27)24-13-5-6-17-7-10-19(11-8-17)26-14-3-4-15-26/h7-12,16H,3-6,13-15H2,1-2H3,(H,24,27)(H,25,28) |
| InChIKey | RMQAMEADOWFNLL-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 79.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.50 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|