C6H6N4S2 — CID 118428593
5-(imidazol-1-ylmethyl)-3H-1,3,4-thiadiazole-2-thione (PubChem CID 118428593) has the molecular formula C6H6N4S2 and a molecular weight of 198.28 g/mol. Its IUPAC name is 5-(imidazol-1-ylmethyl)-3H-1,3,4-thiadiazole-2-thione.
| Compound Name | 5-(imidazol-1-ylmethyl)-3H-1,3,4-thiadiazole-2-thione |
|---|---|
| PubChem CID | 118428593 |
| Molecular Formula | C6H6N4S2 |
| Molecular Weight | 198.28 g/mol |
| Exact Mass | 198.00 |
| IUPAC Name | 5-(imidazol-1-ylmethyl)-3H-1,3,4-thiadiazole-2-thione |
| SMILES | S=c1[nH]nc(Cn2ccnc2)s1 |
| InChI | InChI=1S/C6H6N4S2/c11-6-9-8-5(12-6)3-10-2-1-7-4-10/h1-2,4H,3H2,(H,9,11) |
| InChIKey | SLLJRHWVCAWUFK-UHFFFAOYSA-N |
| XLogP | 1.45 |
| TPSA | 46.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.28 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|