C7H9N5S — CID 130585923
3-(imidazol-1-ylmethyl)-4-methyl-1H-1,2,4-triazole-5-thione (PubChem CID 130585923) has the molecular formula C7H9N5S and a molecular weight of 195.25 g/mol. Its IUPAC name is 3-(imidazol-1-ylmethyl)-4-methyl-1H-1,2,4-triazole-5-thione.
| Compound Name | 3-(imidazol-1-ylmethyl)-4-methyl-1H-1,2,4-triazole-5-thione |
|---|---|
| PubChem CID | 130585923 |
| Molecular Formula | C7H9N5S |
| Molecular Weight | 195.25 g/mol |
| Exact Mass | 195.06 |
| IUPAC Name | 3-(imidazol-1-ylmethyl)-4-methyl-1H-1,2,4-triazole-5-thione |
| SMILES | Cn1c(Cn2ccnc2)n[nH]c1=S |
| InChI | InChI=1S/C7H9N5S/c1-11-6(9-10-7(11)13)4-12-3-2-8-5-12/h2-3,5H,4H2,1H3,(H,10,13) |
| InChIKey | RGZWGKGVZPCCLB-UHFFFAOYSA-N |
| XLogP | 0.72 |
| TPSA | 51.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 195.25 |
| LogP ≤ 5 | 0.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|