C5H5N5S2 — CID 102224792
5-(1,2,4-triazol-4-ylmethyl)-3H-1,3,4-thiadiazole-2-thione (PubChem CID 102224792) has the molecular formula C5H5N5S2 and a molecular weight of 199.26 g/mol. Its IUPAC name is 5-(1,2,4-triazol-4-ylmethyl)-3H-1,3,4-thiadiazole-2-thione.
| Compound Name | 5-(1,2,4-triazol-4-ylmethyl)-3H-1,3,4-thiadiazole-2-thione |
|---|---|
| PubChem CID | 102224792 |
| Molecular Formula | C5H5N5S2 |
| Molecular Weight | 199.26 g/mol |
| Exact Mass | 199.00 |
| IUPAC Name | 5-(1,2,4-triazol-4-ylmethyl)-3H-1,3,4-thiadiazole-2-thione |
| SMILES | S=c1[nH]nc(Cn2cnnc2)s1 |
| InChI | InChI=1S/C5H5N5S2/c11-5-9-8-4(12-5)1-10-2-6-7-3-10/h2-3H,1H2,(H,9,11) |
| InChIKey | XZZHUUAXPYEFGM-UHFFFAOYSA-N |
| XLogP | 0.84 |
| TPSA | 59.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 199.26 |
| LogP ≤ 5 | 0.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|