C13H20N4S2 — CID 23007330
5-[(3,5-dimethyl-1-pentylpyrazol-4-yl)methyl]-3H-1,3,4-thiadiazole-2-thione (PubChem CID 23007330) has the molecular formula C13H20N4S2 and a molecular weight of 296.46 g/mol. Its IUPAC name is 5-[(3,5-dimethyl-1-pentylpyrazol-4-yl)methyl]-3H-1,3,4-thiadiazole-2-thione.
| Compound Name | 5-[(3,5-dimethyl-1-pentylpyrazol-4-yl)methyl]-3H-1,3,4-thiadiazole-2-thione |
|---|---|
| PubChem CID | 23007330 |
| Molecular Formula | C13H20N4S2 |
| Molecular Weight | 296.46 g/mol |
| Exact Mass | 296.11 |
| IUPAC Name | 5-[(3,5-dimethyl-1-pentylpyrazol-4-yl)methyl]-3H-1,3,4-thiadiazole-2-thione |
| SMILES | CCCCCn1nc(C)c(Cc2n[nH]c(=S)s2)c1C |
| InChI | InChI=1S/C13H20N4S2/c1-4-5-6-7-17-10(3)11(9(2)16-17)8-12-14-15-13(18)19-12/h4-8H2,1-3H3,(H,15,18) |
| InChIKey | ROQFFASHGGEIEB-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 46.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.46 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|