C10H7F3N2OS2 — CID 141471118
5-[[4-(trifluoromethyl)phenoxy]methyl]-3H-1,3,4-thiadiazole-2-thione (PubChem CID 141471118) has the molecular formula C10H7F3N2OS2 and a molecular weight of 292.31 g/mol. Its IUPAC name is 5-[[4-(trifluoromethyl)phenoxy]methyl]-3H-1,3,4-thiadiazole-2-thione.
| Compound Name | 5-[[4-(trifluoromethyl)phenoxy]methyl]-3H-1,3,4-thiadiazole-2-thione |
|---|---|
| PubChem CID | 141471118 |
| Molecular Formula | C10H7F3N2OS2 |
| Molecular Weight | 292.31 g/mol |
| Exact Mass | 292.00 |
| IUPAC Name | 5-[[4-(trifluoromethyl)phenoxy]methyl]-3H-1,3,4-thiadiazole-2-thione |
| SMILES | FC(F)(F)c1ccc(OCc2n[nH]c(=S)s2)cc1 |
| InChI | InChI=1S/C10H7F3N2OS2/c11-10(12,13)6-1-3-7(4-2-6)16-5-8-14-15-9(17)18-8/h1-4H,5H2,(H,15,17) |
| InChIKey | FQPXUTYUZAGJKT-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 37.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.31 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|