C9H12N4S2 — CID 23007186
5-(1,3-diethylpyrazol-5-yl)-3H-1,3,4-thiadiazole-2-thione (PubChem CID 23007186) has the molecular formula C9H12N4S2 and a molecular weight of 240.36 g/mol. Its IUPAC name is 5-(1,3-diethylpyrazol-5-yl)-3H-1,3,4-thiadiazole-2-thione.
| Compound Name | 5-(1,3-diethylpyrazol-5-yl)-3H-1,3,4-thiadiazole-2-thione |
|---|---|
| PubChem CID | 23007186 |
| Molecular Formula | C9H12N4S2 |
| Molecular Weight | 240.36 g/mol |
| Exact Mass | 240.05 |
| IUPAC Name | 5-(1,3-diethylpyrazol-5-yl)-3H-1,3,4-thiadiazole-2-thione |
| SMILES | CCc1cc(-c2n[nH]c(=S)s2)n(CC)n1 |
| InChI | InChI=1S/C9H12N4S2/c1-3-6-5-7(13(4-2)12-6)8-10-11-9(14)15-8/h5H,3-4H2,1-2H3,(H,11,14) |
| InChIKey | XJRMGKXBYVTTPB-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 46.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.36 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|