C15H19BrN2 — CID 153295952
5-(4-bromo-2-ethylphenyl)-1,3-diethylpyrazole (PubChem CID 153295952) has the molecular formula C15H19BrN2 and a molecular weight of 307.24 g/mol. Its IUPAC name is 5-(4-bromo-2-ethylphenyl)-1,3-diethylpyrazole.
| Compound Name | 5-(4-bromo-2-ethylphenyl)-1,3-diethylpyrazole |
|---|---|
| PubChem CID | 153295952 |
| Molecular Formula | C15H19BrN2 |
| Molecular Weight | 307.24 g/mol |
| Exact Mass | 306.07 |
| IUPAC Name | 5-(4-bromo-2-ethylphenyl)-1,3-diethylpyrazole |
| SMILES | CCc1cc(-c2ccc(Br)cc2CC)n(CC)n1 |
| InChI | InChI=1S/C15H19BrN2/c1-4-11-9-12(16)7-8-14(11)15-10-13(5-2)17-18(15)6-3/h7-10H,4-6H2,1-3H3 |
| InChIKey | FVLRYHAUOAAOLY-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.24 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |